C27H32N10O3 — CID 89202125
5-[[1-[4-(2-aminoacetyl)phenyl]-4-cyanopyrazol-3-yl]diazenyl]-2,6-bis(3-methoxypropylamino)-4-methylpyridine-3-carbonitrile (PubChem CID 89202125) has the molecular formula C27H32N10O3 and a molecular weight of 544.62 g/mol. Its IUPAC name is 5-[[1-[4-(2-aminoacetyl)phenyl]-4-cyanopyrazol-3-yl]diazenyl]-2,6-bis(3-methoxypropylamino)-4-methylpyridine-3-carbonitrile.
| Compound Name | 5-[[1-[4-(2-aminoacetyl)phenyl]-4-cyanopyrazol-3-yl]diazenyl]-2,6-bis(3-methoxypropylamino)-4-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 89202125 |
| Molecular Formula | C27H32N10O3 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 5-[[1-[4-(2-aminoacetyl)phenyl]-4-cyanopyrazol-3-yl]diazenyl]-2,6-bis(3-methoxypropylamino)-4-methylpyridine-3-carbonitrile |
| SMILES | COCCCNc1nc(NCCCOC)c(/N=N/c2nn(-c3ccc(C(=O)CN)cc3)cc2C#N)c(C)c1C#N |
| InChI | InChI=1S/C27H32N10O3/c1-18-22(15-29)26(31-10-4-12-39-2)33-27(32-11-5-13-40-3)24(18)34-35-25-20(14-28)17-37(36-25)21-8-6-19(7-9-21)23(38)16-30/h6-9,17H,4-5,10-13,16,30H2,1-3H3,(H2,31,32,33)/b35-34+ |
| InChIKey | XMVMMVDJDBWRBQ-XAHDOWKMSA-N |
| XLogP | 3.77 |
| TPSA | 188.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|