C28H35N11O4S2 — CID 59207394
3-[[5-[[1-(1,3-benzothiazol-2-yl)-4-cyanopyrazol-3-yl]diazenyl]-2,6-bis(1-methoxypropan-2-ylamino)pyrimidin-4-yl]amino]propyl 2-sulfanylacetate (PubChem CID 59207394) has the molecular formula C28H35N11O4S2 and a molecular weight of 653.80 g/mol. Its IUPAC name is 3-[[5-[[1-(1,3-benzothiazol-2-yl)-4-cyanopyrazol-3-yl]diazenyl]-2,6-bis(1-methoxypropan-2-ylamino)pyrimidin-4-yl]amino]propyl 2-sulfanylacetate.
| Compound Name | 3-[[5-[[1-(1,3-benzothiazol-2-yl)-4-cyanopyrazol-3-yl]diazenyl]-2,6-bis(1-methoxypropan-2-ylamino)pyrimidin-4-yl]amino]propyl 2-sulfanylacetate |
|---|---|
| PubChem CID | 59207394 |
| Molecular Formula | C28H35N11O4S2 |
| Molecular Weight | 653.80 g/mol |
| Exact Mass | 653.23 |
| IUPAC Name | 3-[[5-[[1-(1,3-benzothiazol-2-yl)-4-cyanopyrazol-3-yl]diazenyl]-2,6-bis(1-methoxypropan-2-ylamino)pyrimidin-4-yl]amino]propyl 2-sulfanylacetate |
| SMILES | COCC(C)Nc1nc(NCCCOC(=O)CS)c(/N=N/c2nn(-c3nc4ccccc4s3)cc2C#N)c(NC(C)COC)n1 |
| InChI | InChI=1S/C28H35N11O4S2/c1-17(14-41-3)31-26-23(25(30-10-7-11-43-22(40)16-44)34-27(35-26)32-18(2)15-42-4)36-37-24-19(12-29)13-39(38-24)28-33-20-8-5-6-9-21(20)45-28/h5-6,8-9,13,17-18,44H,7,10-11,14-16H2,1-4H3,(H3,30,31,32,34,35)/b37-36+ |
| InChIKey | AXWZNEMSJDVURR-BSRQYYOTSA-N |
| XLogP | 4.73 |
| TPSA | 185.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.80 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|