C26H35N11O5 — CID 59294970
3-[[2,4-bis(1-methoxypropan-2-ylamino)-6-(3-methoxypropylamino)pyrimidin-5-yl]diazenyl]-1-(4-nitrophenyl)pyrazole-4-carbonitrile (PubChem CID 59294970) has the molecular formula C26H35N11O5 and a molecular weight of 581.64 g/mol. Its IUPAC name is 3-[[2,4-bis(1-methoxypropan-2-ylamino)-6-(3-methoxypropylamino)pyrimidin-5-yl]diazenyl]-1-(4-nitrophenyl)pyrazole-4-carbonitrile.
| Compound Name | 3-[[2,4-bis(1-methoxypropan-2-ylamino)-6-(3-methoxypropylamino)pyrimidin-5-yl]diazenyl]-1-(4-nitrophenyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 59294970 |
| Molecular Formula | C26H35N11O5 |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 3-[[2,4-bis(1-methoxypropan-2-ylamino)-6-(3-methoxypropylamino)pyrimidin-5-yl]diazenyl]-1-(4-nitrophenyl)pyrazole-4-carbonitrile |
| SMILES | COCCCNc1nc(NC(C)COC)nc(NC(C)COC)c1/N=N/c1nn(-c2ccc([N+](=O)[O-])cc2)cc1C#N |
| InChI | InChI=1S/C26H35N11O5/c1-17(15-41-4)29-25-22(24(28-11-6-12-40-3)31-26(32-25)30-18(2)16-42-5)33-34-23-19(13-27)14-36(35-23)20-7-9-21(10-8-20)37(38)39/h7-10,14,17-18H,6,11-12,15-16H2,1-5H3,(H3,28,29,30,31,32)/b34-33+ |
| InChIKey | GBRHTGOTXOPSFQ-JEIPZWNWSA-N |
| XLogP | 4.20 |
| TPSA | 199.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|