C27H32N8O8S3 — CID 143390706
2-[[5-cyano-6-[2-(2-hydroxyethylsulfinyl)ethylamino]-2-(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfinophenyl)diazenyl]benzenesulfonic acid (PubChem CID 143390706) has the molecular formula C27H32N8O8S3 and a molecular weight of 692.80 g/mol. Its IUPAC name is 2-[[5-cyano-6-[2-(2-hydroxyethylsulfinyl)ethylamino]-2-(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfinophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[5-cyano-6-[2-(2-hydroxyethylsulfinyl)ethylamino]-2-(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfinophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 143390706 |
| Molecular Formula | C27H32N8O8S3 |
| Molecular Weight | 692.80 g/mol |
| Exact Mass | 692.15 |
| IUPAC Name | 2-[[5-cyano-6-[2-(2-hydroxyethylsulfinyl)ethylamino]-2-(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfinophenyl)diazenyl]benzenesulfonic acid |
| SMILES | COCCCNc1nc(NCCS(=O)CCO)c(C#N)c(C)c1/N=N/c1ccc(/N=N/c2ccc(S(=O)O)cc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C27H32N8O8S3/c1-18-22(17-28)26(30-11-14-44(37)15-12-36)31-27(29-10-3-13-43-2)25(18)35-34-23-9-6-20(16-24(23)46(40,41)42)33-32-19-4-7-21(8-5-19)45(38)39/h4-9,16,36H,3,10-15H2,1-2H3,(H,38,39)(H2,29,30,31)(H,40,41,42)/b33-32+,35-34+ |
| InChIKey | DDLNONTVPZMLAR-VPHDGDOJSA-N |
| XLogP | 4.52 |
| TPSA | 248.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.80 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|