C25H36IN7O6S — CID 89363747
2-[[5-[[4-[2-[bis(2-hydroxypropyl)amino]ethylsulfonyl]phenyl]diazenyl]-3-cyano-6-(2-hydroxyethylamino)-4-methyl-2-pyridinyl]amino]ethyl hypoiodite (PubChem CID 89363747) has the molecular formula C25H36IN7O6S and a molecular weight of 689.58 g/mol. Its IUPAC name is 2-[[5-[[4-[2-[bis(2-hydroxypropyl)amino]ethylsulfonyl]phenyl]diazenyl]-3-cyano-6-(2-hydroxyethylamino)-4-methyl-2-pyridinyl]amino]ethyl hypoiodite.
| Compound Name | 2-[[5-[[4-[2-[bis(2-hydroxypropyl)amino]ethylsulfonyl]phenyl]diazenyl]-3-cyano-6-(2-hydroxyethylamino)-4-methyl-2-pyridinyl]amino]ethyl hypoiodite |
|---|---|
| PubChem CID | 89363747 |
| Molecular Formula | C25H36IN7O6S |
| Molecular Weight | 689.58 g/mol |
| Exact Mass | 689.15 |
| IUPAC Name | 2-[[5-[[4-[2-[bis(2-hydroxypropyl)amino]ethylsulfonyl]phenyl]diazenyl]-3-cyano-6-(2-hydroxyethylamino)-4-methyl-2-pyridinyl]amino]ethyl hypoiodite |
| SMILES | Cc1c(C#N)c(NCCOI)nc(NCCO)c1/N=N/c1ccc(S(=O)(=O)CCN(CC(C)O)CC(C)O)cc1 |
| InChI | InChI=1S/C25H36IN7O6S/c1-17(35)15-33(16-18(2)36)10-13-40(37,38)21-6-4-20(5-7-21)31-32-23-19(3)22(14-27)24(29-9-12-39-26)30-25(23)28-8-11-34/h4-7,17-18,34-36H,8-13,15-16H2,1-3H3,(H2,28,29,30)/b32-31+ |
| InChIKey | SRLBXWYNTRZNPA-QNEJGDQOSA-N |
| XLogP | 2.70 |
| TPSA | 192.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|