C34H47N7O7S — CID 89196641
6-anilino-5-[[4-[2-[bis(2-hydroxypropyl)amino]ethylsulfonyl]-5-ethyl-2-methoxyphenyl]diazenyl]-2-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridine-3-carbonitrile (PubChem CID 89196641) has the molecular formula C34H47N7O7S and a molecular weight of 697.86 g/mol. Its IUPAC name is 6-anilino-5-[[4-[2-[bis(2-hydroxypropyl)amino]ethylsulfonyl]-5-ethyl-2-methoxyphenyl]diazenyl]-2-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridine-3-carbonitrile.
| Compound Name | 6-anilino-5-[[4-[2-[bis(2-hydroxypropyl)amino]ethylsulfonyl]-5-ethyl-2-methoxyphenyl]diazenyl]-2-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 89196641 |
| Molecular Formula | C34H47N7O7S |
| Molecular Weight | 697.86 g/mol |
| Exact Mass | 697.33 |
| IUPAC Name | 6-anilino-5-[[4-[2-[bis(2-hydroxypropyl)amino]ethylsulfonyl]-5-ethyl-2-methoxyphenyl]diazenyl]-2-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridine-3-carbonitrile |
| SMILES | CCc1cc(/N=N/c2c(Nc3ccccc3)nc(NCCOCCO)c(C#N)c2C)c(OC)cc1S(=O)(=O)CCN(CC(C)O)CC(C)O |
| InChI | InChI=1S/C34H47N7O7S/c1-6-26-18-29(30(47-5)19-31(26)49(45,46)17-13-41(21-23(2)43)22-24(3)44)39-40-32-25(4)28(20-35)33(36-12-15-48-16-14-42)38-34(32)37-27-10-8-7-9-11-27/h7-11,18-19,23-24,42-44H,6,12-17,21-22H2,1-5H3,(H2,36,37,38)/b40-39+ |
| InChIKey | BLXWAGPWGHBRCE-XQQUEIPISA-N |
| XLogP | 4.25 |
| TPSA | 201.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.86 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|