C31H45N7O7S — CID 89220586
2-[2-[4-[[5-amino-2-anilino-6-[2-(2-hydroxyethoxy)ethylamino]-4-methyl-3-pyridinyl]diazenyl]-2,5-dimethoxyphenyl]sulfonylethyl-propylamino]ethanol (PubChem CID 89220586) has the molecular formula C31H45N7O7S and a molecular weight of 659.81 g/mol. Its IUPAC name is 2-[2-[4-[[5-amino-2-anilino-6-[2-(2-hydroxyethoxy)ethylamino]-4-methyl-3-pyridinyl]diazenyl]-2,5-dimethoxyphenyl]sulfonylethyl-propylamino]ethanol.
| Compound Name | 2-[2-[4-[[5-amino-2-anilino-6-[2-(2-hydroxyethoxy)ethylamino]-4-methyl-3-pyridinyl]diazenyl]-2,5-dimethoxyphenyl]sulfonylethyl-propylamino]ethanol |
|---|---|
| PubChem CID | 89220586 |
| Molecular Formula | C31H45N7O7S |
| Molecular Weight | 659.81 g/mol |
| Exact Mass | 659.31 |
| IUPAC Name | 2-[2-[4-[[5-amino-2-anilino-6-[2-(2-hydroxyethoxy)ethylamino]-4-methyl-3-pyridinyl]diazenyl]-2,5-dimethoxyphenyl]sulfonylethyl-propylamino]ethanol |
| SMILES | CCCN(CCO)CCS(=O)(=O)c1cc(OC)c(/N=N/c2c(Nc3ccccc3)nc(NCCOCCO)c(N)c2C)cc1OC |
| InChI | InChI=1S/C31H45N7O7S/c1-5-12-38(13-15-39)14-19-46(41,42)27-21-25(43-3)24(20-26(27)44-4)36-37-29-22(2)28(32)30(33-11-17-45-18-16-40)35-31(29)34-23-9-7-6-8-10-23/h6-10,20-21,39-40H,5,11-19,32H2,1-4H3,(H2,33,34,35)/b37-36+ |
| InChIKey | UBOXFNZFGPFKFK-BSRQYYOTSA-N |
| XLogP | 4.05 |
| TPSA | 193.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.81 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|