C28H42N6O7S — CID 89196606
1-[2-[4-[[5-ethynyl-2,6-bis(2-hydroxyethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-methoxy-2-methylphenyl]sulfonylethyl-(2-hydroxypropyl)amino]propan-2-ol (PubChem CID 89196606) has the molecular formula C28H42N6O7S and a molecular weight of 606.75 g/mol. Its IUPAC name is 1-[2-[4-[[5-ethynyl-2,6-bis(2-hydroxyethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-methoxy-2-methylphenyl]sulfonylethyl-(2-hydroxypropyl)amino]propan-2-ol.
| Compound Name | 1-[2-[4-[[5-ethynyl-2,6-bis(2-hydroxyethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-methoxy-2-methylphenyl]sulfonylethyl-(2-hydroxypropyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 89196606 |
| Molecular Formula | C28H42N6O7S |
| Molecular Weight | 606.75 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | 1-[2-[4-[[5-ethynyl-2,6-bis(2-hydroxyethylamino)-4-methyl-3-pyridinyl]diazenyl]-5-methoxy-2-methylphenyl]sulfonylethyl-(2-hydroxypropyl)amino]propan-2-ol |
| SMILES | C#Cc1c(NCCO)nc(NCCO)c(/N=N/c2cc(C)c(S(=O)(=O)CCN(CC(C)O)CC(C)O)cc2OC)c1C |
| InChI | InChI=1S/C28H42N6O7S/c1-7-22-21(5)26(28(30-9-12-36)31-27(22)29-8-11-35)33-32-23-14-18(2)25(15-24(23)41-6)42(39,40)13-10-34(16-19(3)37)17-20(4)38/h1,14-15,19-20,35-38H,8-13,16-17H2,2-6H3,(H2,29,30,31)/b33-32+ |
| InChIKey | QJEUNOBAAXHAEF-ULIFNZDWSA-N |
| XLogP | 1.75 |
| TPSA | 189.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.75 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|