C31H41N7O5S — CID 58231815
2-anilino-5-[[4-[2-[butan-2-yl(2-hydroxyethyl)amino]ethylsulfonyl]phenyl]diazenyl]-6-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridine-3-carbonitrile (PubChem CID 58231815) has the molecular formula C31H41N7O5S and a molecular weight of 623.78 g/mol. Its IUPAC name is 2-anilino-5-[[4-[2-[butan-2-yl(2-hydroxyethyl)amino]ethylsulfonyl]phenyl]diazenyl]-6-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridine-3-carbonitrile.
| Compound Name | 2-anilino-5-[[4-[2-[butan-2-yl(2-hydroxyethyl)amino]ethylsulfonyl]phenyl]diazenyl]-6-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 58231815 |
| Molecular Formula | C31H41N7O5S |
| Molecular Weight | 623.78 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | 2-anilino-5-[[4-[2-[butan-2-yl(2-hydroxyethyl)amino]ethylsulfonyl]phenyl]diazenyl]-6-[2-(2-hydroxyethoxy)ethylamino]-4-methylpyridine-3-carbonitrile |
| SMILES | CCC(C)N(CCO)CCS(=O)(=O)c1ccc(/N=N/c2c(NCCOCCO)nc(Nc3ccccc3)c(C#N)c2C)cc1 |
| InChI | InChI=1S/C31H41N7O5S/c1-4-23(2)38(15-17-39)16-21-44(41,42)27-12-10-26(11-13-27)36-37-29-24(3)28(22-32)30(34-25-8-6-5-7-9-25)35-31(29)33-14-19-43-20-18-40/h5-13,23,39-40H,4,14-21H2,1-3H3,(H2,33,34,35)/b37-36+ |
| InChIKey | GUKHNTOHTITAQX-BSRQYYOTSA-N |
| XLogP | 4.71 |
| TPSA | 172.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.78 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|