C28H38N8O12S4 — CID 89385167
2-[[5-amino-2,6-bis[2-(2-hydroxyethylsulfonyl)ethyl-methylamino]-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid (PubChem CID 89385167) has the molecular formula C28H38N8O12S4 and a molecular weight of 806.92 g/mol. Its IUPAC name is 2-[[5-amino-2,6-bis[2-(2-hydroxyethylsulfonyl)ethyl-methylamino]-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[5-amino-2,6-bis[2-(2-hydroxyethylsulfonyl)ethyl-methylamino]-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89385167 |
| Molecular Formula | C28H38N8O12S4 |
| Molecular Weight | 806.92 g/mol |
| Exact Mass | 806.15 |
| IUPAC Name | 2-[[5-amino-2,6-bis[2-(2-hydroxyethylsulfonyl)ethyl-methylamino]-4-methyl-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
| SMILES | Cc1c(N)c(N(C)CCS(=O)(=O)CCO)nc(N(C)CCS(=O)(=O)CCO)c1/N=N/c1ccc(/N=N/c2ccc(S(=O)(=O)O)cc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C28H38N8O12S4/c1-19-25(29)27(35(2)10-14-49(39,40)16-12-37)30-28(36(3)11-15-50(41,42)17-13-38)26(19)34-33-23-9-6-21(18-24(23)52(46,47)48)32-31-20-4-7-22(8-5-20)51(43,44)45/h4-9,18,37-38H,10-17,29H2,1-3H3,(H,43,44,45)(H,46,47,48)/b32-31+,34-33+ |
| InChIKey | AHSGAKXTPCWGSL-HSBKYFPUSA-N |
| XLogP | 1.98 |
| TPSA | 312.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.92 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|