C13H25N3O2 — CID 59848387
4-azido-2-tert-butyl-5-(2,2-dimethylpropyl)oxolan-3-ol (PubChem CID 59848387) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 4-azido-2-tert-butyl-5-(2,2-dimethylpropyl)oxolan-3-ol.
| Compound Name | 4-azido-2-tert-butyl-5-(2,2-dimethylpropyl)oxolan-3-ol |
|---|---|
| PubChem CID | 59848387 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 4-azido-2-tert-butyl-5-(2,2-dimethylpropyl)oxolan-3-ol |
| SMILES | CC(C)(C)CC1OC(C(C)(C)C)C(O)C1N=[N+]=[N-] |
| InChI | InChI=1S/C13H25N3O2/c1-12(2,3)7-8-9(15-16-14)10(17)11(18-8)13(4,5)6/h8-11,17H,7H2,1-6H3 |
| InChIKey | YYQJHYJNHZUWNP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|