C17H34O2 — CID 177125372
(2R,4S,5R)-4,5-ditert-butyl-2-(2,2-dimethylpropyl)oxolan-3-ol (PubChem CID 177125372) has the molecular formula C17H34O2 and a molecular weight of 270.46 g/mol. Its IUPAC name is (2R,4S,5R)-4,5-ditert-butyl-2-(2,2-dimethylpropyl)oxolan-3-ol.
| Compound Name | (2R,4S,5R)-4,5-ditert-butyl-2-(2,2-dimethylpropyl)oxolan-3-ol |
|---|---|
| PubChem CID | 177125372 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | (2R,4S,5R)-4,5-ditert-butyl-2-(2,2-dimethylpropyl)oxolan-3-ol |
| SMILES | CC(C)(C)C[C@H]1O[C@@H](C(C)(C)C)[C@@H](C(C)(C)C)C1O |
| InChI | InChI=1S/C17H34O2/c1-15(2,3)10-11-13(18)12(16(4,5)6)14(19-11)17(7,8)9/h11-14,18H,10H2,1-9H3/t11-,12+,13?,14-/m1/s1 |
| InChIKey | GBKQLNGTJNASKF-QNMSZWNNSA-N |
| XLogP | 4.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |