C12H24O3 — CID 149499592
3,4-ditert-butyloxolane-2,5-diol (PubChem CID 149499592) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is 3,4-ditert-butyloxolane-2,5-diol.
| Compound Name | 3,4-ditert-butyloxolane-2,5-diol |
|---|---|
| PubChem CID | 149499592 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 3,4-ditert-butyloxolane-2,5-diol |
| SMILES | CC(C)(C)C1C(O)OC(O)C1C(C)(C)C |
| InChI | InChI=1S/C12H24O3/c1-11(2,3)7-8(12(4,5)6)10(14)15-9(7)13/h7-10,13-14H,1-6H3 |
| InChIKey | ZGSOOBGQAGLWIP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |