C21H14F5N3O3 — CID 59848948
N-(2,2,3,3,6-pentafluoro-1,4-benzodioxin-7-yl)-2-(pyridin-4-ylmethylamino)benzamide (PubChem CID 59848948) has the molecular formula C21H14F5N3O3 and a molecular weight of 451.35 g/mol. Its IUPAC name is N-(2,2,3,3,6-pentafluoro-1,4-benzodioxin-7-yl)-2-(pyridin-4-ylmethylamino)benzamide.
| Compound Name | N-(2,2,3,3,6-pentafluoro-1,4-benzodioxin-7-yl)-2-(pyridin-4-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 59848948 |
| Molecular Formula | C21H14F5N3O3 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-(2,2,3,3,6-pentafluoro-1,4-benzodioxin-7-yl)-2-(pyridin-4-ylmethylamino)benzamide |
| SMILES | O=C(Nc1cc2c(cc1F)OC(F)(F)C(F)(F)O2)c1ccccc1NCc1ccncc1 |
| InChI | InChI=1S/C21H14F5N3O3/c22-14-9-17-18(32-21(25,26)20(23,24)31-17)10-16(14)29-19(30)13-3-1-2-4-15(13)28-11-12-5-7-27-8-6-12/h1-10,28H,11H2,(H,29,30) |
| InChIKey | BXUOZXRRFSUXRG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|