C23H17F5N4O4 — CID 59848995
N-methyl-4-[[2-[(2,2,3,3,6-pentafluoro-1,4-benzodioxin-7-yl)carbamoyl]anilino]methyl]pyridine-2-carboxamide (PubChem CID 59848995) has the molecular formula C23H17F5N4O4 and a molecular weight of 508.40 g/mol. Its IUPAC name is N-methyl-4-[[2-[(2,2,3,3,6-pentafluoro-1,4-benzodioxin-7-yl)carbamoyl]anilino]methyl]pyridine-2-carboxamide.
| Compound Name | N-methyl-4-[[2-[(2,2,3,3,6-pentafluoro-1,4-benzodioxin-7-yl)carbamoyl]anilino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59848995 |
| Molecular Formula | C23H17F5N4O4 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | N-methyl-4-[[2-[(2,2,3,3,6-pentafluoro-1,4-benzodioxin-7-yl)carbamoyl]anilino]methyl]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(CNc2ccccc2C(=O)Nc2cc3c(cc2F)OC(F)(F)C(F)(F)O3)ccn1 |
| InChI | InChI=1S/C23H17F5N4O4/c1-29-21(34)17-8-12(6-7-30-17)11-31-15-5-3-2-4-13(15)20(33)32-16-10-19-18(9-14(16)24)35-22(25,26)23(27,28)36-19/h2-10,31H,11H2,1H3,(H,29,34)(H,32,33) |
| InChIKey | GOFWVJPOEYGSFY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|