C23H32N2 — CID 59850010
3,3-bis(4-tert-butylphenyl)propanimidamide (PubChem CID 59850010) has the molecular formula C23H32N2 and a molecular weight of 336.52 g/mol. Its IUPAC name is 3,3-bis(4-tert-butylphenyl)propanimidamide.
| Compound Name | 3,3-bis(4-tert-butylphenyl)propanimidamide |
|---|---|
| PubChem CID | 59850010 |
| Molecular Formula | C23H32N2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | 3,3-bis(4-tert-butylphenyl)propanimidamide |
| SMILES | [H]/N=C(\N)CC(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H32N2/c1-22(2,3)18-11-7-16(8-12-18)20(15-21(24)25)17-9-13-19(14-10-17)23(4,5)6/h7-14,20H,15H2,1-6H3,(H3,24,25) |
| InChIKey | ARZALDMREJGYFZ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|