C47H57NO9 — CID 59853223
[4-[2-[4-[(4-heptoxy-2,5-dimethoxybenzoyl)-methylamino]phenyl]ethynyl]phenyl] 4-heptoxy-2,5-dimethoxybenzoate (PubChem CID 59853223) has the molecular formula C47H57NO9 and a molecular weight of 779.97 g/mol. Its IUPAC name is [4-[2-[4-[(4-heptoxy-2,5-dimethoxybenzoyl)-methylamino]phenyl]ethynyl]phenyl] 4-heptoxy-2,5-dimethoxybenzoate.
| Compound Name | [4-[2-[4-[(4-heptoxy-2,5-dimethoxybenzoyl)-methylamino]phenyl]ethynyl]phenyl] 4-heptoxy-2,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 59853223 |
| Molecular Formula | C47H57NO9 |
| Molecular Weight | 779.97 g/mol |
| Exact Mass | 779.40 |
| IUPAC Name | [4-[2-[4-[(4-heptoxy-2,5-dimethoxybenzoyl)-methylamino]phenyl]ethynyl]phenyl] 4-heptoxy-2,5-dimethoxybenzoate |
| SMILES | CCCCCCCOc1cc(OC)c(C(=O)Oc2ccc(C#Cc3ccc(N(C)C(=O)c4cc(OC)c(OCCCCCCC)cc4OC)cc3)cc2)cc1OC |
| InChI | InChI=1S/C47H57NO9/c1-8-10-12-14-16-28-55-44-32-40(51-4)38(30-42(44)53-6)46(49)48(3)36-24-20-34(21-25-36)18-19-35-22-26-37(27-23-35)57-47(50)39-31-43(54-7)45(33-41(39)52-5)56-29-17-15-13-11-9-2/h20-27,30-33H,8-17,28-29H2,1-7H3 |
| InChIKey | SXYZXHJYMOIQRE-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.97 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|