About CID 59853765
CID 59853765 (PubChem CID 59853765) has the molecular formula C6H14BN
and a molecular weight of 111.00 g/mol.
Molecular Properties
| Compound Name | CID 59853765 |
| PubChem CID | 59853765 |
| Molecular Formula | C6H14BN |
| Molecular Weight | 111.00 g/mol |
| Exact Mass | 111.12 |
| IUPAC Name | — |
| SMILES | [B]C[C@@H](CC)NCC |
| InChI | InChI=1S/C6H14BN/c1-3-6(5-7)8-4-2/h6,8H,3-5H2,1-2H3/t6-/m1/s1 |
| InChIKey | VMIOAFBZYGFLKI-ZCFIWIBFSA-N |
| XLogP | 0.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.00 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59853765 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59853765?
The IUPAC name of CID 59853765 (CID 59853765) is not available.
What is the SMILES notation for CID 59853765?
The canonical SMILES for CID 59853765 is [B]C[C@@H](CC)NCC.
What is the InChIKey of CID 59853765?
The InChIKey is VMIOAFBZYGFLKI-ZCFIWIBFSA-N. The full InChI is InChI=1S/C6H14BN/c1-3-6(5-7)8-4-2/h6,8H,3-5H2,1-2H3/t6-/m1/s1.
What are the key properties of CID 59853765?
CID 59853765 has a molecular weight of 111.00 g/mol, XLogP of 0.96, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59853765 is sourced from PubChem (CID 59853765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).