C23H25BrN2O5S — CID 59854655
7-bromo-3-butyl-2-(3,4,5-trimethoxyphenyl)-6,7-dihydro-5H-[1]benzothiolo[2,3-d]pyrimidine-4,8-dione (PubChem CID 59854655) has the molecular formula C23H25BrN2O5S and a molecular weight of 521.43 g/mol. Its IUPAC name is 7-bromo-3-butyl-2-(3,4,5-trimethoxyphenyl)-6,7-dihydro-5H-[1]benzothiolo[2,3-d]pyrimidine-4,8-dione.
| Compound Name | 7-bromo-3-butyl-2-(3,4,5-trimethoxyphenyl)-6,7-dihydro-5H-[1]benzothiolo[2,3-d]pyrimidine-4,8-dione |
|---|---|
| PubChem CID | 59854655 |
| Molecular Formula | C23H25BrN2O5S |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | 7-bromo-3-butyl-2-(3,4,5-trimethoxyphenyl)-6,7-dihydro-5H-[1]benzothiolo[2,3-d]pyrimidine-4,8-dione |
| SMILES | CCCCn1c(-c2cc(OC)c(OC)c(OC)c2)nc2sc3c(c2c1=O)CCC(Br)C3=O |
| InChI | InChI=1S/C23H25BrN2O5S/c1-5-6-9-26-21(12-10-15(29-2)19(31-4)16(11-12)30-3)25-22-17(23(26)28)13-7-8-14(24)18(27)20(13)32-22/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | URGADRBPWPPKMY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|