C21H15Cl2N5OS3 — CID 59854909
6-amino-11-[(3,5-dichlorophenyl)carbamothioyl]-8-thiophen-2-yl-4-thia-2,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-5-carboxamide (PubChem CID 59854909) has the molecular formula C21H15Cl2N5OS3 and a molecular weight of 520.49 g/mol. Its IUPAC name is 6-amino-11-[(3,5-dichlorophenyl)carbamothioyl]-8-thiophen-2-yl-4-thia-2,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-5-carboxamide.
| Compound Name | 6-amino-11-[(3,5-dichlorophenyl)carbamothioyl]-8-thiophen-2-yl-4-thia-2,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 59854909 |
| Molecular Formula | C21H15Cl2N5OS3 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 518.98 |
| IUPAC Name | 6-amino-11-[(3,5-dichlorophenyl)carbamothioyl]-8-thiophen-2-yl-4-thia-2,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-5-carboxamide |
| SMILES | NC(=O)c1sc2nc3c(c(-c4cccs4)c2c1N)CN(C(=S)Nc1cc(Cl)cc(Cl)c1)C3 |
| InChI | InChI=1S/C21H15Cl2N5OS3/c22-9-4-10(23)6-11(5-9)26-21(30)28-7-12-13(8-28)27-20-16(15(12)14-2-1-3-31-14)17(24)18(32-20)19(25)29/h1-6H,7-8,24H2,(H2,25,29)(H,26,30) |
| InChIKey | XXEKXVUBYRYIPA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|