C21H17Cl2N5OS3 — CID 89211897
6-amino-11-[(3,5-dichlorophenyl)carbamothioyl]-8-thiophen-2-yl-4-thia-2,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,7-triene-5-carboxamide (PubChem CID 89211897) has the molecular formula C21H17Cl2N5OS3 and a molecular weight of 522.51 g/mol. Its IUPAC name is 6-amino-11-[(3,5-dichlorophenyl)carbamothioyl]-8-thiophen-2-yl-4-thia-2,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,7-triene-5-carboxamide.
| Compound Name | 6-amino-11-[(3,5-dichlorophenyl)carbamothioyl]-8-thiophen-2-yl-4-thia-2,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,7-triene-5-carboxamide |
|---|---|
| PubChem CID | 89211897 |
| Molecular Formula | C21H17Cl2N5OS3 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 521.00 |
| IUPAC Name | 6-amino-11-[(3,5-dichlorophenyl)carbamothioyl]-8-thiophen-2-yl-4-thia-2,11-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,7-triene-5-carboxamide |
| SMILES | NC(=O)C1Sc2nc3c(c(-c4cccs4)c2C1N)CN(C(=S)Nc1cc(Cl)cc(Cl)c1)C3 |
| InChI | InChI=1S/C21H17Cl2N5OS3/c22-9-4-10(23)6-11(5-9)26-21(30)28-7-12-13(8-28)27-20-16(15(12)14-2-1-3-31-14)17(24)18(32-20)19(25)29/h1-6,17-18H,7-8,24H2,(H2,25,29)(H,26,30) |
| InChIKey | MAZCUSLRJWLUPC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|