C21H19N3O6S2 — CID 59855191
[2-carbamoyl-5-(5,6-dimethoxybenzimidazol-1-yl)thiophen-3-yl] 2-methylbenzenesulfonate (PubChem CID 59855191) has the molecular formula C21H19N3O6S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is [2-carbamoyl-5-(5,6-dimethoxybenzimidazol-1-yl)thiophen-3-yl] 2-methylbenzenesulfonate.
| Compound Name | [2-carbamoyl-5-(5,6-dimethoxybenzimidazol-1-yl)thiophen-3-yl] 2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59855191 |
| Molecular Formula | C21H19N3O6S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | [2-carbamoyl-5-(5,6-dimethoxybenzimidazol-1-yl)thiophen-3-yl] 2-methylbenzenesulfonate |
| SMILES | COc1cc2ncn(-c3cc(OS(=O)(=O)c4ccccc4C)c(C(N)=O)s3)c2cc1OC |
| InChI | InChI=1S/C21H19N3O6S2/c1-12-6-4-5-7-18(12)32(26,27)30-17-10-19(31-20(17)21(22)25)24-11-23-13-8-15(28-2)16(29-3)9-14(13)24/h4-11H,1-3H3,(H2,22,25) |
| InChIKey | KWURWIUCRMFFFK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|