C22H19ClN4O6S — CID 68568805
3-[(1R)-1-(2-chloro-3-nitrophenyl)ethoxy]-5-(5,6-dimethoxybenzimidazol-1-yl)thiophene-2-carboxamide (PubChem CID 68568805) has the molecular formula C22H19ClN4O6S and a molecular weight of 502.94 g/mol. Its IUPAC name is 3-[(1R)-1-(2-chloro-3-nitrophenyl)ethoxy]-5-(5,6-dimethoxybenzimidazol-1-yl)thiophene-2-carboxamide.
| Compound Name | 3-[(1R)-1-(2-chloro-3-nitrophenyl)ethoxy]-5-(5,6-dimethoxybenzimidazol-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 68568805 |
| Molecular Formula | C22H19ClN4O6S |
| Molecular Weight | 502.94 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 3-[(1R)-1-(2-chloro-3-nitrophenyl)ethoxy]-5-(5,6-dimethoxybenzimidazol-1-yl)thiophene-2-carboxamide |
| SMILES | COc1cc2ncn(-c3cc(O[C@H](C)c4cccc([N+](=O)[O-])c4Cl)c(C(N)=O)s3)c2cc1OC |
| InChI | InChI=1S/C22H19ClN4O6S/c1-11(12-5-4-6-14(20(12)23)27(29)30)33-18-9-19(34-21(18)22(24)28)26-10-25-13-7-16(31-2)17(32-3)8-15(13)26/h4-11H,1-3H3,(H2,24,28)/t11-/m1/s1 |
| InChIKey | PWXAQZNVVKKJOG-LLVKDONJSA-N |
| XLogP | 4.90 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.94 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|