C28H31N3O5S — CID 59856371
2-[(3-amino-6,8-dimethylpyren-1-yl)sulfonylamino]-6-(2-methylprop-2-enoylamino)hexanoic acid (PubChem CID 59856371) has the molecular formula C28H31N3O5S and a molecular weight of 521.64 g/mol. Its IUPAC name is 2-[(3-amino-6,8-dimethylpyren-1-yl)sulfonylamino]-6-(2-methylprop-2-enoylamino)hexanoic acid.
| Compound Name | 2-[(3-amino-6,8-dimethylpyren-1-yl)sulfonylamino]-6-(2-methylprop-2-enoylamino)hexanoic acid |
|---|---|
| PubChem CID | 59856371 |
| Molecular Formula | C28H31N3O5S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 2-[(3-amino-6,8-dimethylpyren-1-yl)sulfonylamino]-6-(2-methylprop-2-enoylamino)hexanoic acid |
| SMILES | C=C(C)C(=O)NCCCCC(NS(=O)(=O)c1cc(N)c2ccc3c(C)cc(C)c4ccc1c2c34)C(=O)O |
| InChI | InChI=1S/C28H31N3O5S/c1-15(2)27(32)30-12-6-5-7-23(28(33)34)31-37(35,36)24-14-22(29)20-10-8-18-16(3)13-17(4)19-9-11-21(24)26(20)25(18)19/h8-11,13-14,23,31H,1,5-7,12,29H2,2-4H3,(H,30,32)(H,33,34) |
| InChIKey | JMKHDQOJFMAUGW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|