C26H25N3O11S3-2 — CID 59856374
8-amino-6-[[1-carboxy-5-(2-methylprop-2-enoylamino)pentyl]sulfamoyl]-3-oxidoperoxysulfanylpyrene-1-sulfonate (PubChem CID 59856374) has the molecular formula C26H25N3O11S3-2 and a molecular weight of 651.70 g/mol. Its IUPAC name is 8-amino-6-[[1-carboxy-5-(2-methylprop-2-enoylamino)pentyl]sulfamoyl]-3-oxidoperoxysulfanylpyrene-1-sulfonate.
| Compound Name | 8-amino-6-[[1-carboxy-5-(2-methylprop-2-enoylamino)pentyl]sulfamoyl]-3-oxidoperoxysulfanylpyrene-1-sulfonate |
|---|---|
| PubChem CID | 59856374 |
| Molecular Formula | C26H25N3O11S3-2 |
| Molecular Weight | 651.70 g/mol |
| Exact Mass | 651.07 |
| IUPAC Name | 8-amino-6-[[1-carboxy-5-(2-methylprop-2-enoylamino)pentyl]sulfamoyl]-3-oxidoperoxysulfanylpyrene-1-sulfonate |
| SMILES | C=C(C)C(=O)NCCCCC(NS(=O)(=O)c1cc(N)c2ccc3c(S(=O)(=O)[O-])cc(SOO[O-])c4ccc1c2c43)C(=O)O |
| InChI | InChI=1S/C26H27N3O11S3/c1-13(2)25(30)28-10-4-3-5-19(26(31)32)29-42(34,35)21-11-18(27)14-6-8-17-22(43(36,37)38)12-20(41-40-39-33)15-7-9-16(21)23(14)24(15)17/h6-9,11-12,19,29,33H,1,3-5,10,27H2,2H3,(H,28,30)(H,31,32)(H,36,37,38)/p-2 |
| InChIKey | LTVNSWWVJIRRPJ-UHFFFAOYSA-L |
| XLogP | 1.89 |
| TPSA | 237.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.70 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|