C26H27N3O14S4 — CID 59550516
8-hydroxy-6-[[1-[3-(2-methylprop-2-enoylamino)propylamino]-1-oxo-3-(trioxidanylsulfanyl)propan-2-yl]sulfamoyl]-3-(trioxidanylsulfanyl)pyrene-1-sulfonic acid (PubChem CID 59550516) has the molecular formula C26H27N3O14S4 and a molecular weight of 733.78 g/mol. Its IUPAC name is 8-hydroxy-6-[[1-[3-(2-methylprop-2-enoylamino)propylamino]-1-oxo-3-(trioxidanylsulfanyl)propan-2-yl]sulfamoyl]-3-(trioxidanylsulfanyl)pyrene-1-sulfonic acid.
| Compound Name | 8-hydroxy-6-[[1-[3-(2-methylprop-2-enoylamino)propylamino]-1-oxo-3-(trioxidanylsulfanyl)propan-2-yl]sulfamoyl]-3-(trioxidanylsulfanyl)pyrene-1-sulfonic acid |
|---|---|
| PubChem CID | 59550516 |
| Molecular Formula | C26H27N3O14S4 |
| Molecular Weight | 733.78 g/mol |
| Exact Mass | 733.04 |
| IUPAC Name | 8-hydroxy-6-[[1-[3-(2-methylprop-2-enoylamino)propylamino]-1-oxo-3-(trioxidanylsulfanyl)propan-2-yl]sulfamoyl]-3-(trioxidanylsulfanyl)pyrene-1-sulfonic acid |
| SMILES | C=C(C)C(=O)NCCCNC(=O)C(CSOOO)NS(=O)(=O)c1cc(O)c2ccc3c(S(=O)(=O)O)cc(SOOO)c4ccc1c2c43 |
| InChI | InChI=1S/C26H27N3O14S4/c1-13(2)25(31)27-8-3-9-28-26(32)18(12-44-42-40-33)29-46(35,36)21-10-19(30)14-4-6-17-22(47(37,38)39)11-20(45-43-41-34)15-5-7-16(21)23(14)24(15)17/h4-7,10-11,18,29-30,33-34H,1,3,8-9,12H2,2H3,(H,27,31)(H,28,32)(H,37,38,39) |
| InChIKey | XGXNUJKRANKUMP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 256.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|