C25H28N2O4S3 — CID 143761153
ethane;N-[3-[[3-hydroxy-6,8-bis(hydroxysulfanyl)pyren-1-yl]sulfanylamino]propyl]-2-methylprop-2-enamide (PubChem CID 143761153) has the molecular formula C25H28N2O4S3 and a molecular weight of 516.71 g/mol. Its IUPAC name is ethane;N-[3-[[3-hydroxy-6,8-bis(hydroxysulfanyl)pyren-1-yl]sulfanylamino]propyl]-2-methylprop-2-enamide.
| Compound Name | ethane;N-[3-[[3-hydroxy-6,8-bis(hydroxysulfanyl)pyren-1-yl]sulfanylamino]propyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 143761153 |
| Molecular Formula | C25H28N2O4S3 |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | ethane;N-[3-[[3-hydroxy-6,8-bis(hydroxysulfanyl)pyren-1-yl]sulfanylamino]propyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCNSc1cc(O)c2ccc3c(SO)cc(SO)c4ccc1c2c34.CC |
| InChI | InChI=1S/C23H22N2O4S3.C2H6/c1-12(2)23(27)24-8-3-9-25-30-18-10-17(26)13-4-5-15-19(31-28)11-20(32-29)16-7-6-14(18)21(13)22(15)16;1-2/h4-7,10-11,25-26,28-29H,1,3,8-9H2,2H3,(H,24,27);1-2H3 |
| InChIKey | QQSJTPQWAYZKSD-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|