C28H29N3O9S2 — CID 59562252
2-[(3-acetyloxypyren-1-yl)sulfonylamino]-3-[3-(2-methylprop-2-enoylamino)propylamino]-3-oxopropane-1-sulfonic acid (PubChem CID 59562252) has the molecular formula C28H29N3O9S2 and a molecular weight of 615.69 g/mol. Its IUPAC name is 2-[(3-acetyloxypyren-1-yl)sulfonylamino]-3-[3-(2-methylprop-2-enoylamino)propylamino]-3-oxopropane-1-sulfonic acid.
| Compound Name | 2-[(3-acetyloxypyren-1-yl)sulfonylamino]-3-[3-(2-methylprop-2-enoylamino)propylamino]-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 59562252 |
| Molecular Formula | C28H29N3O9S2 |
| Molecular Weight | 615.69 g/mol |
| Exact Mass | 615.13 |
| IUPAC Name | 2-[(3-acetyloxypyren-1-yl)sulfonylamino]-3-[3-(2-methylprop-2-enoylamino)propylamino]-3-oxopropane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)NCCCNC(=O)C(CS(=O)(=O)O)NS(=O)(=O)c1cc(OC(C)=O)c2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C28H29N3O9S2/c1-16(2)27(33)29-12-5-13-30-28(34)22(15-41(35,36)37)31-42(38,39)24-14-23(40-17(3)32)20-10-8-18-6-4-7-19-9-11-21(24)26(20)25(18)19/h4,6-11,14,22,31H,1,5,12-13,15H2,2-3H3,(H,29,33)(H,30,34)(H,35,36,37) |
| InChIKey | LNGUDVFUTXWVSU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 185.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.69 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|