C29H21F6IrNO2 — CID 59859332
3-[9,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]isoquinoline;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium (PubChem CID 59859332) has the molecular formula C29H21F6IrNO2 and a molecular weight of 721.70 g/mol. Its IUPAC name is 3-[9,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]isoquinoline;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium.
| Compound Name | 3-[9,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]isoquinoline;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
|---|---|
| PubChem CID | 59859332 |
| Molecular Formula | C29H21F6IrNO2 |
| Molecular Weight | 721.70 g/mol |
| Exact Mass | 722.11 |
| IUPAC Name | 3-[9,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]isoquinoline;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
| SMILES | FC(F)(F)C1(C(F)(F)F)c2ccccc2-c2c[c-]c(-c3cc4ccccc4cn3)cc21.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C24H12F6N.C5H8O2.Ir/c25-23(26,27)22(24(28,29)30)19-8-4-3-7-17(19)18-10-9-15(11-20(18)22)21-12-14-5-1-2-6-16(14)13-31-21;1-4(6)3-5(2)7;/h1-8,10-13H;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | LJOCKYMIVWADJZ-LWFKIUJUSA-O |
| XLogP | 8.10 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.70 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|