C31H17F9IrN2O2 — CID 59859394
iridium;pyridine-2-carbonyloxidanium;2-[7,9,9-tris(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline (PubChem CID 59859394) has the molecular formula C31H17F9IrN2O2 and a molecular weight of 812.69 g/mol. Its IUPAC name is iridium;pyridine-2-carbonyloxidanium;2-[7,9,9-tris(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline.
| Compound Name | iridium;pyridine-2-carbonyloxidanium;2-[7,9,9-tris(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline |
|---|---|
| PubChem CID | 59859394 |
| Molecular Formula | C31H17F9IrN2O2 |
| Molecular Weight | 812.69 g/mol |
| Exact Mass | 813.08 |
| IUPAC Name | iridium;pyridine-2-carbonyloxidanium;2-[7,9,9-tris(trifluoromethyl)-3H-fluoren-3-id-2-yl]quinoline |
| SMILES | FC(F)(F)c1ccc2c(c1)C(C(F)(F)F)(C(F)(F)F)c1cc(-c3ccc4ccccc4n3)[c-]cc1-2.O=C([OH2+])c1ccccn1.[Ir] |
| InChI | InChI=1S/C25H11F9N.C6H5NO2.Ir/c26-23(27,28)15-7-9-17-16-8-5-14(21-10-6-13-3-1-2-4-20(13)35-21)11-18(16)22(19(17)12-15,24(29,30)31)25(32,33)34;8-6(9)5-3-1-2-4-7-5;/h1-4,6-12H;1-4H,(H,8,9);/q-1;;/p+1 |
| InChIKey | LWMPYDBNVWGUNX-UHFFFAOYSA-O |
| XLogP | 8.06 |
| TPSA | 65.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.69 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|