C38H22F6IrN2-2 — CID 59859405
10H-benzo[h]quinolin-10-ide;iridium;3-[9-methyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]isoquinoline (PubChem CID 59859405) has the molecular formula C38H22F6IrN2-2 and a molecular weight of 812.81 g/mol. Its IUPAC name is 10H-benzo[h]quinolin-10-ide;iridium;3-[9-methyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]isoquinoline.
| Compound Name | 10H-benzo[h]quinolin-10-ide;iridium;3-[9-methyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]isoquinoline |
|---|---|
| PubChem CID | 59859405 |
| Molecular Formula | C38H22F6IrN2-2 |
| Molecular Weight | 812.81 g/mol |
| Exact Mass | 813.13 |
| IUPAC Name | 10H-benzo[h]quinolin-10-ide;iridium;3-[9-methyl-7,9-bis(trifluoromethyl)-3H-fluoren-3-id-2-yl]isoquinoline |
| SMILES | CC1(C(F)(F)F)c2cc(-c3cc4ccccc4cn3)[c-]cc2-c2ccc(C(F)(F)F)cc21.[Ir].[c-]1cccc2ccc3cccnc3c12 |
| InChI | InChI=1S/C25H14F6N.C13H8N.Ir/c1-23(25(29,30)31)20-10-15(22-11-14-4-2-3-5-16(14)13-32-22)6-8-18(20)19-9-7-17(12-21(19)23)24(26,27)28;1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12;/h2-5,7-13H,1H3;1-5,7-9H;/q2*-1; |
| InChIKey | UKRRGGAYSVLUDG-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.81 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|