C16H9F5N2 — CID 11174725
3-(1,1,2,2,2-pentafluoroethyl)-1-pyridin-3-ylisoquinoline (PubChem CID 11174725) has the molecular formula C16H9F5N2 and a molecular weight of 324.25 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentafluoroethyl)-1-pyridin-3-ylisoquinoline.
| Compound Name | 3-(1,1,2,2,2-pentafluoroethyl)-1-pyridin-3-ylisoquinoline |
|---|---|
| PubChem CID | 11174725 |
| Molecular Formula | C16H9F5N2 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 3-(1,1,2,2,2-pentafluoroethyl)-1-pyridin-3-ylisoquinoline |
| SMILES | FC(F)(F)C(F)(F)c1cc2ccccc2c(-c2cccnc2)n1 |
| InChI | InChI=1S/C16H9F5N2/c17-15(18,16(19,20)21)13-8-10-4-1-2-6-12(10)14(23-13)11-5-3-7-22-9-11/h1-9H |
| InChIKey | XNTABVIOWFXEMF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|