C33H21F3IrN2S-2 — CID 59859409
iridium;3-[9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]isoquinoline;2-(3H-thiophen-3-id-2-yl)pyridine (PubChem CID 59859409) has the molecular formula C33H21F3IrN2S-2 and a molecular weight of 726.82 g/mol. Its IUPAC name is iridium;3-[9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]isoquinoline;2-(3H-thiophen-3-id-2-yl)pyridine.
| Compound Name | iridium;3-[9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]isoquinoline;2-(3H-thiophen-3-id-2-yl)pyridine |
|---|---|
| PubChem CID | 59859409 |
| Molecular Formula | C33H21F3IrN2S-2 |
| Molecular Weight | 726.82 g/mol |
| Exact Mass | 727.10 |
| IUPAC Name | iridium;3-[9-methyl-9-(trifluoromethyl)-3H-fluoren-3-id-2-yl]isoquinoline;2-(3H-thiophen-3-id-2-yl)pyridine |
| SMILES | CC1(C(F)(F)F)c2ccccc2-c2c[c-]c(-c3cc4ccccc4cn3)cc21.[Ir].[c-]1ccsc1-c1ccccn1 |
| InChI | InChI=1S/C24H15F3N.C9H6NS.Ir/c1-23(24(25,26)27)20-9-5-4-8-18(20)19-11-10-16(12-21(19)23)22-13-15-6-2-3-7-17(15)14-28-22;1-2-6-10-8(4-1)9-5-3-7-11-9;/h2-9,11-14H,1H3;1-4,6-7H;/q2*-1; |
| InChIKey | ZKWAFKRNNMXGGM-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.82 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|