C53H70BrN2O12 — CID 59862163
CID 59862163 (PubChem CID 59862163) has the molecular formula C53H70BrN2O12 and a molecular weight of 1007.05 g/mol.
| Compound Name | CID 59862163 |
|---|---|
| PubChem CID | 59862163 |
| Molecular Formula | C53H70BrN2O12 |
| Molecular Weight | 1007.05 g/mol |
| Exact Mass | 1005.41 |
| IUPAC Name | — |
| SMILES | C=C1C[C@@H]2C[C@@H]3C[CH]C[C@@H](O3)c3coc(n3)/C=C/C[C@H]3O[C@@H](/C(C)=C/c4coc(C[C@]5(O)C[C@H](OC)C[C@H]([C@H](O)/C=C(C)/C=C/[C@@H](C/C=C/Br)OC)O5)n4)[C@H](C)[C@@H](OC(=O)/C=C\C[C@@H](C1)O2)[C@H]3C |
| InChI | InChI=1S/C53H70BrN2O12/c1-32(19-20-38(60-6)14-11-21-54)24-44(57)47-27-42(61-7)28-53(59,68-47)29-49-55-37(30-62-49)25-34(3)51-36(5)52-35(4)45(66-51)15-10-17-48-56-43(31-63-48)46-16-8-12-40(65-46)26-41-23-33(2)22-39(64-41)13-9-18-50(58)67-52/h8-11,17-21,24-25,30-31,35-36,38-42,44-47,51-52,57,59H,2,12-16,22-23,26-29H2,1,3-7H3/b17-10+,18-9-,20-19+,21-11+,32-24+,34-25+/t35-,36-,38+,39-,40-,41+,42+,44+,45+,46+,47+,51-,52-,53-/m0/s1 |
| InChIKey | IRTNHPJVPKVMDJ-VHYZXWCHSA-N |
| XLogP | 9.60 |
| TPSA | 174.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.05 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|