C33H45NO7 — CID 72651025
11-but-2-en-2-yl-27-hydroxy-12,31-dimethyl-21-methylidene-4,10,14,29,30-pentaoxa-32-azapentacyclo[23.3.1.12,5.19,13.119,23]dotriaconta-2,5(32),6,16-tetraen-15-one (PubChem CID 72651025) has the molecular formula C33H45NO7 and a molecular weight of 567.72 g/mol. Its IUPAC name is 11-but-2-en-2-yl-27-hydroxy-12,31-dimethyl-21-methylidene-4,10,14,29,30-pentaoxa-32-azapentacyclo[23.3.1.12,5.19,13.119,23]dotriaconta-2,5(32),6,16-tetraen-15-one.
| Compound Name | 11-but-2-en-2-yl-27-hydroxy-12,31-dimethyl-21-methylidene-4,10,14,29,30-pentaoxa-32-azapentacyclo[23.3.1.12,5.19,13.119,23]dotriaconta-2,5(32),6,16-tetraen-15-one |
|---|---|
| PubChem CID | 72651025 |
| Molecular Formula | C33H45NO7 |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | 11-but-2-en-2-yl-27-hydroxy-12,31-dimethyl-21-methylidene-4,10,14,29,30-pentaoxa-32-azapentacyclo[23.3.1.12,5.19,13.119,23]dotriaconta-2,5(32),6,16-tetraen-15-one |
| SMILES | C=C1CC2CC=CC(=O)OC3C(C)C(CC=Cc4nc(co4)C4CC(O)CC(CC(C1)O2)O4)OC(C(C)=CC)C3C |
| InChI | InChI=1S/C33H45NO7/c1-6-20(3)32-22(5)33-21(4)28(40-32)10-8-11-30-34-27(18-37-30)29-16-23(35)15-26(39-29)17-25-14-19(2)13-24(38-25)9-7-12-31(36)41-33/h6-8,11-12,18,21-26,28-29,32-33,35H,2,9-10,13-17H2,1,3-5H3 |
| InChIKey | ZHEVSXACEFTULV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|