C32H40N2O7 — CID 74960271
3-(12,31-dimethyl-21-methylidene-15-oxo-4,10,14,28,29,30-hexaoxa-32-azapentacyclo[23.3.1.12,5.19,13.119,23]dotriaconta-2,5(32),6,16-tetraen-11-yl)but-2-enenitrile (PubChem CID 74960271) has the molecular formula C32H40N2O7 and a molecular weight of 564.68 g/mol. Its IUPAC name is 3-(12,31-dimethyl-21-methylidene-15-oxo-4,10,14,28,29,30-hexaoxa-32-azapentacyclo[23.3.1.12,5.19,13.119,23]dotriaconta-2,5(32),6,16-tetraen-11-yl)but-2-enenitrile.
| Compound Name | 3-(12,31-dimethyl-21-methylidene-15-oxo-4,10,14,28,29,30-hexaoxa-32-azapentacyclo[23.3.1.12,5.19,13.119,23]dotriaconta-2,5(32),6,16-tetraen-11-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 74960271 |
| Molecular Formula | C32H40N2O7 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | 3-(12,31-dimethyl-21-methylidene-15-oxo-4,10,14,28,29,30-hexaoxa-32-azapentacyclo[23.3.1.12,5.19,13.119,23]dotriaconta-2,5(32),6,16-tetraen-11-yl)but-2-enenitrile |
| SMILES | C=C1CC2CC=CC(=O)OC3C(C)C(CC=Cc4nc(co4)C4OCCC(CC(C1)O2)O4)OC(C(C)=CC#N)C3C |
| InChI | InChI=1S/C32H40N2O7/c1-19-15-23-7-5-10-29(35)41-31-21(3)27(40-30(22(31)4)20(2)11-13-33)8-6-9-28-34-26(18-37-28)32-36-14-12-24(39-32)17-25(16-19)38-23/h5-6,9-11,18,21-25,27,30-32H,1,7-8,12,14-17H2,2-4H3 |
| InChIKey | UQZRODFNAOBGCU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|