C33H42N2O7 — CID 74959523
3-(27-hydroxy-12,31-dimethyl-21-methylidene-15-oxo-4,10,14,29,30-pentaoxa-32-azapentacyclo[23.3.1.12,5.19,13.119,23]dotriaconta-2,5(32),6,16-tetraen-11-yl)but-2-enenitrile (PubChem CID 74959523) has the molecular formula C33H42N2O7 and a molecular weight of 578.71 g/mol. Its IUPAC name is 3-(27-hydroxy-12,31-dimethyl-21-methylidene-15-oxo-4,10,14,29,30-pentaoxa-32-azapentacyclo[23.3.1.12,5.19,13.119,23]dotriaconta-2,5(32),6,16-tetraen-11-yl)but-2-enenitrile.
| Compound Name | 3-(27-hydroxy-12,31-dimethyl-21-methylidene-15-oxo-4,10,14,29,30-pentaoxa-32-azapentacyclo[23.3.1.12,5.19,13.119,23]dotriaconta-2,5(32),6,16-tetraen-11-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 74959523 |
| Molecular Formula | C33H42N2O7 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | 3-(27-hydroxy-12,31-dimethyl-21-methylidene-15-oxo-4,10,14,29,30-pentaoxa-32-azapentacyclo[23.3.1.12,5.19,13.119,23]dotriaconta-2,5(32),6,16-tetraen-11-yl)but-2-enenitrile |
| SMILES | C=C1CC2CC=CC(=O)OC3C(C)C(CC=Cc4nc(co4)C4CC(O)CC(CC(C1)O2)O4)OC(C(C)=CC#N)C3C |
| InChI | InChI=1S/C33H42N2O7/c1-19-13-24-7-5-10-31(37)42-33-21(3)28(41-32(22(33)4)20(2)11-12-34)8-6-9-30-35-27(18-38-30)29-16-23(36)15-26(40-29)17-25(14-19)39-24/h5-6,9-11,18,21-26,28-29,32-33,36H,1,7-8,13-17H2,2-4H3 |
| InChIKey | YTQSRBIUUZXQQA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|