C24H29NO3 — CID 59863269
1-(7-methoxy-6-phenylmethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-3-methylidenehexan-2-one (PubChem CID 59863269) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-(7-methoxy-6-phenylmethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-3-methylidenehexan-2-one.
| Compound Name | 1-(7-methoxy-6-phenylmethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-3-methylidenehexan-2-one |
|---|---|
| PubChem CID | 59863269 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-(7-methoxy-6-phenylmethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-3-methylidenehexan-2-one |
| SMILES | C=C(CCC)C(=O)CC1NCCc2cc(OCc3ccccc3)c(OC)cc21 |
| InChI | InChI=1S/C24H29NO3/c1-4-8-17(2)22(26)15-21-20-14-23(27-3)24(13-19(20)11-12-25-21)28-16-18-9-6-5-7-10-18/h5-7,9-10,13-14,21,25H,2,4,8,11-12,15-16H2,1,3H3 |
| InChIKey | ZWIDACRWDSDRNC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|