C30H30F3N7O2 — CID 59864165
1-[2-methyl-4-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyphenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 59864165) has the molecular formula C30H30F3N7O2 and a molecular weight of 577.61 g/mol. Its IUPAC name is 1-[2-methyl-4-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyphenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-methyl-4-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 59864165 |
| Molecular Formula | C30H30F3N7O2 |
| Molecular Weight | 577.61 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | 1-[2-methyl-4-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1cc(Oc2ccnc(Nc3ccc(N4CCN(C)CC4)cc3)n2)ccc1NC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H30F3N7O2/c1-20-18-25(10-11-26(20)37-29(41)36-23-5-3-4-21(19-23)30(31,32)33)42-27-12-13-34-28(38-27)35-22-6-8-24(9-7-22)40-16-14-39(2)15-17-40/h3-13,18-19H,14-17H2,1-2H3,(H,34,35,38)(H2,36,37,41) |
| InChIKey | VCBJCTAAPKUOHH-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|