C22H34N4O2 — CID 59865068
tert-butyl 4-[4-(2-cyano-4-pyridinyl)-2-(dimethylamino)butyl]piperidine-1-carboxylate (PubChem CID 59865068) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is tert-butyl 4-[4-(2-cyano-4-pyridinyl)-2-(dimethylamino)butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(2-cyano-4-pyridinyl)-2-(dimethylamino)butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59865068 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | tert-butyl 4-[4-(2-cyano-4-pyridinyl)-2-(dimethylamino)butyl]piperidine-1-carboxylate |
| SMILES | CN(C)C(CCc1ccnc(C#N)c1)CC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H34N4O2/c1-22(2,3)28-21(27)26-12-9-18(10-13-26)15-20(25(4)5)7-6-17-8-11-24-19(14-17)16-23/h8,11,14,18,20H,6-7,9-10,12-13,15H2,1-5H3 |
| InChIKey | WMLIOTMOSZXDIP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |