C17H16F4N2OS — CID 59866120
N-[3-(cyclopropylmethyl)-4,5-dimethyl-1,3-thiazol-2-ylidene]-2-fluoro-6-(trifluoromethyl)benzamide (PubChem CID 59866120) has the molecular formula C17H16F4N2OS and a molecular weight of 372.39 g/mol. Its IUPAC name is N-[3-(cyclopropylmethyl)-4,5-dimethyl-1,3-thiazol-2-ylidene]-2-fluoro-6-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(cyclopropylmethyl)-4,5-dimethyl-1,3-thiazol-2-ylidene]-2-fluoro-6-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 59866120 |
| Molecular Formula | C17H16F4N2OS |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-[3-(cyclopropylmethyl)-4,5-dimethyl-1,3-thiazol-2-ylidene]-2-fluoro-6-(trifluoromethyl)benzamide |
| SMILES | Cc1s/c(=N/C(=O)c2c(F)cccc2C(F)(F)F)n(CC2CC2)c1C |
| InChI | InChI=1S/C17H16F4N2OS/c1-9-10(2)25-16(23(9)8-11-6-7-11)22-15(24)14-12(17(19,20)21)4-3-5-13(14)18/h3-5,11H,6-8H2,1-2H3/b22-16+ |
| InChIKey | CASATTVCTVEYHO-CJLVFECKSA-N |
| XLogP | 4.48 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|