C12H26N+ — CID 59866555
1,1,2,3,4,5,6-heptamethylpiperidin-1-ium (PubChem CID 59866555) has the molecular formula C12H26N+ and a molecular weight of 184.35 g/mol. Its IUPAC name is 1,1,2,3,4,5,6-heptamethylpiperidin-1-ium.
| Compound Name | 1,1,2,3,4,5,6-heptamethylpiperidin-1-ium |
|---|---|
| PubChem CID | 59866555 |
| Molecular Formula | C12H26N+ |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.21 |
| IUPAC Name | 1,1,2,3,4,5,6-heptamethylpiperidin-1-ium |
| SMILES | CC1C(C)C(C)[N+](C)(C)C(C)C1C |
| InChI | InChI=1S/C12H26N/c1-8-9(2)11(4)13(6,7)12(5)10(8)3/h8-12H,1-7H3/q+1 |
| InChIKey | IHOCJSZCDNVSKT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|