C6H12N+ — CID 5247030
2,5-dimethyl-3-azoniaspiro[2.2]pentane (PubChem CID 5247030) has the molecular formula C6H12N+ and a molecular weight of 98.17 g/mol. Its IUPAC name is 2,5-dimethyl-3-azoniaspiro[2.2]pentane.
| Compound Name | 2,5-dimethyl-3-azoniaspiro[2.2]pentane |
|---|---|
| PubChem CID | 5247030 |
| Molecular Formula | C6H12N+ |
| Molecular Weight | 98.17 g/mol |
| Exact Mass | 98.10 |
| IUPAC Name | 2,5-dimethyl-3-azoniaspiro[2.2]pentane |
| SMILES | CC1C[N+]12CC2C |
| InChI | InChI=1S/C6H12N/c1-5-3-7(5)4-6(7)2/h5-6H,3-4H2,1-2H3/q+1 |
| InChIKey | XOMRTMJSNVRWIA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|