C19H32BN — CID 99768700
1-[(2S,5S,7R)-2-methyl-1-boranuidatricyclo[3.3.1.13,7]decan-1-yl]-1-azoniatricyclo[3.3.1.13,7]decane (PubChem CID 99768700) has the molecular formula C19H32BN and a molecular weight of 285.28 g/mol. Its IUPAC name is 1-[(2S,5S,7R)-2-methyl-1-boranuidatricyclo[3.3.1.13,7]decan-1-yl]-1-azoniatricyclo[3.3.1.13,7]decane.
| Compound Name | 1-[(2S,5S,7R)-2-methyl-1-boranuidatricyclo[3.3.1.13,7]decan-1-yl]-1-azoniatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 99768700 |
| Molecular Formula | C19H32BN |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.26 |
| IUPAC Name | 1-[(2S,5S,7R)-2-methyl-1-boranuidatricyclo[3.3.1.13,7]decan-1-yl]-1-azoniatricyclo[3.3.1.13,7]decane |
| SMILES | C[C@H]1C2C[C@@H]3C[C@H](C2)C[B-]1([N+]12CC4CC(CC(C4)C1)C2)C3 |
| InChI | InChI=1S/C19H32BN/c1-13-19-6-14-2-15(7-19)9-20(13,8-14)21-10-16-3-17(11-21)5-18(4-16)12-21/h13-19H,2-12H2,1H3/t13-,14-,15+,16?,17?,18?,19?,20?,21?/m0/s1 |
| InChIKey | WIMXRVNOXBVMOS-MGFGYVECSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|