C24H22ClN7 — CID 59867442
N-(4-chlorophenyl)-3-phenyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyridazin-4-amine (PubChem CID 59867442) has the molecular formula C24H22ClN7 and a molecular weight of 443.94 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-phenyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyridazin-4-amine.
| Compound Name | N-(4-chlorophenyl)-3-phenyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyridazin-4-amine |
|---|---|
| PubChem CID | 59867442 |
| Molecular Formula | C24H22ClN7 |
| Molecular Weight | 443.94 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | N-(4-chlorophenyl)-3-phenyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyridazin-4-amine |
| SMILES | Clc1ccc(Nc2cc(N3CCN(c4ncccn4)CC3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22ClN7/c25-19-7-9-20(10-8-19)28-21-17-22(29-30-23(21)18-5-2-1-3-6-18)31-13-15-32(16-14-31)24-26-11-4-12-27-24/h1-12,17H,13-16H2,(H,28,29) |
| InChIKey | NPNALLNTRXWXSB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.94 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |