C25H43Cl2MnN5S — CID 59867680
(4R,9R,14R,19R)-24-tert-butylsulfanyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-triene;dichloromanganese (PubChem CID 59867680) has the molecular formula C25H43Cl2MnN5S and a molecular weight of 571.57 g/mol. Its IUPAC name is (4R,9R,14R,19R)-24-tert-butylsulfanyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-triene;dichloromanganese.
| Compound Name | (4R,9R,14R,19R)-24-tert-butylsulfanyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-triene;dichloromanganese |
|---|---|
| PubChem CID | 59867680 |
| Molecular Formula | C25H43Cl2MnN5S |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | (4R,9R,14R,19R)-24-tert-butylsulfanyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-triene;dichloromanganese |
| SMILES | CC(C)(C)Sc1cc2nc(c1)CN[C@@H]1CCCC[C@H]1NCCN[C@@H]1CCCC[C@H]1NC2.Cl[Mn]Cl |
| InChI | InChI=1S/C25H43N5S.2ClH.Mn/c1-25(2,3)31-20-14-18-16-28-23-10-6-4-8-21(23)26-12-13-27-22-9-5-7-11-24(22)29-17-19(15-20)30-18;;;/h14-15,21-24,26-29H,4-13,16-17H2,1-3H3;2*1H;/q;;;+2/p-2/t21-,22-,23-,24-;;;/m1.../s1 |
| InChIKey | VNTMDXTYRMSTAR-KFMKQTIHSA-L |
| XLogP | 5.34 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |