C25H41Cl2MnN5O2S — CID 59383849
dichloromanganese;ethyl 2-[[(4R,9R,14R,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-trien-24-yl]sulfanyl]acetate (PubChem CID 59383849) has the molecular formula C25H41Cl2MnN5O2S and a molecular weight of 601.55 g/mol. Its IUPAC name is dichloromanganese;ethyl 2-[[(4R,9R,14R,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-trien-24-yl]sulfanyl]acetate.
| Compound Name | dichloromanganese;ethyl 2-[[(4R,9R,14R,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-trien-24-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 59383849 |
| Molecular Formula | C25H41Cl2MnN5O2S |
| Molecular Weight | 601.55 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | dichloromanganese;ethyl 2-[[(4R,9R,14R,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-trien-24-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1cc2nc(c1)CN[C@@H]1CCCC[C@H]1NCCN[C@@H]1CCCC[C@H]1NC2.Cl[Mn]Cl |
| InChI | InChI=1S/C25H41N5O2S.2ClH.Mn/c1-2-32-25(31)17-33-20-13-18-15-28-23-9-5-3-7-21(23)26-11-12-27-22-8-4-6-10-24(22)29-16-19(14-20)30-18;;;/h13-14,21-24,26-29H,2-12,15-17H2,1H3;2*1H;/q;;;+2/p-2/t21-,22-,23-,24-;;;/m1.../s1 |
| InChIKey | UCXQWNNEBNTOFV-KFMKQTIHSA-L |
| XLogP | 4.11 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |