C22H25NO5S — CID 55397223
ethyl 1-[2-(2-naphthalen-2-ylsulfanylacetyl)oxyacetyl]piperidine-2-carboxylate (PubChem CID 55397223) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is ethyl 1-[2-(2-naphthalen-2-ylsulfanylacetyl)oxyacetyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[2-(2-naphthalen-2-ylsulfanylacetyl)oxyacetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 55397223 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | ethyl 1-[2-(2-naphthalen-2-ylsulfanylacetyl)oxyacetyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)COC(=O)CSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H25NO5S/c1-2-27-22(26)19-9-5-6-12-23(19)20(24)14-28-21(25)15-29-18-11-10-16-7-3-4-8-17(16)13-18/h3-4,7-8,10-11,13,19H,2,5-6,9,12,14-15H2,1H3 |
| InChIKey | LTVAAXOKGYXWLA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |