C19H27N3O7 — CID 8653445
ethyl (2R)-1-[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]oxyacetyl]piperidine-2-carboxylate (PubChem CID 8653445) has the molecular formula C19H27N3O7 and a molecular weight of 409.44 g/mol. Its IUPAC name is ethyl (2R)-1-[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]oxyacetyl]piperidine-2-carboxylate.
| Compound Name | ethyl (2R)-1-[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]oxyacetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 8653445 |
| Molecular Formula | C19H27N3O7 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | ethyl (2R)-1-[2-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]oxyacetyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCCN1C(=O)COC(=O)CN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C19H27N3O7/c1-2-28-16(25)13-7-3-6-10-21(13)14(23)12-29-15(24)11-22-17(26)19(20-18(22)27)8-4-5-9-19/h13H,2-12H2,1H3,(H,20,27)/t13-/m1/s1 |
| InChIKey | ZIQJWVDSCRPLIJ-CYBMUJFWSA-N |
| XLogP | 0.34 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|