C16H20F3N3O5 — CID 55401908
ethyl 1-[2-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]oxyacetyl]piperidine-2-carboxylate (PubChem CID 55401908) has the molecular formula C16H20F3N3O5 and a molecular weight of 391.35 g/mol. Its IUPAC name is ethyl 1-[2-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]oxyacetyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[2-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]oxyacetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 55401908 |
| Molecular Formula | C16H20F3N3O5 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | ethyl 1-[2-[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]oxyacetyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)COC(=O)Cn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H20F3N3O5/c1-2-26-15(25)11-5-3-4-7-22(11)13(23)10-27-14(24)9-21-8-6-12(20-21)16(17,18)19/h6,8,11H,2-5,7,9-10H2,1H3 |
| InChIKey | NNEQQRGMUYJLPR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |